CAS 886497-85-4 appears in our catalog under these names: 2–Fluoro–5–(trifluoromethoxy)benzoic acid, 2-Fluoro-5-(trifluoromethoxy)benzoic acid 97%, 2-Fluoro-5-(Trifluoromethoxy)Benzoic Acid, 97%, 97%, 2-Fluoro-5-(trifluoromethoxy)benzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100g.
2-fluoro-5-(trifluoromethoxy)benzoic acid (CAS 886497-85-4) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2-fluoro-5-(trifluoromethoxy)benzoic acid. InChIKey: CSMVUVGPLMTFIZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-fluoro-5-(trifluoromethoxy)benzoic acid |
| InChIKey | CSMVUVGPLMTFIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)C(=O)O)F |
Computed by PubChem (NCBI)