CAS 103467-50-1 is the registry number for 2,2,3,3-Tetrafluoro-6-hydroxybenzodioxene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2,2,3,3-tetrafluoro-1,4-benzodioxin-6-ol (CAS 103467-50-1) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2,2,3,3-tetrafluoro-1,4-benzodioxin-6-ol. InChIKey: QMCVHTQWRXVSMQ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2,2,3,3-tetrafluoro-1,4-benzodioxin-6-ol |
| InChIKey | QMCVHTQWRXVSMQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)OC(C(O2)(F)F)(F)F |
Computed by PubChem (NCBI)