Products 1092460-83-7
CAS 1092460-83-7 appears in our catalog under these names: 2–Trifluoromethoxy–5–fluorobenzoic acid, 5-Fluoro-2-(trifluoromethoxy)benzoic acid 98%, 5-fluoro-2-(trifluoromethoxy)benzoic acid, 98%, 98%, 5-Fluoro-2-(trifluoromethoxy)benzoic acid, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 25g, 10g.
5-fluoro-2-(trifluoromethoxy)benzoic acid (CAS 1092460-83-7) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 5-fluoro-2-(trifluoromethoxy)benzoic acid. InChIKey: JRQMLAPRSGFPRF-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 5-fluoro-2-(trifluoromethoxy)benzoic acid |
| InChIKey | JRQMLAPRSGFPRF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)