Products 1211530-22-1
CAS 1211530-22-1 appears in our catalog under these names: 2-Fluoro-6-(trifluoromethoxy)benzoic acid, 97%, 2-Fluoro-6-(trifluoromethoxy)benzoic acid. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 10g.
2-fluoro-6-(trifluoromethoxy)benzoic acid (CAS 1211530-22-1) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2-fluoro-6-(trifluoromethoxy)benzoic acid. InChIKey: XXDXQIDMSUKZAZ-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-fluoro-6-(trifluoromethoxy)benzoic acid |
| InChIKey | XXDXQIDMSUKZAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)O)OC(F)(F)F |
Computed by PubChem (NCBI)