Products 38512-77-5

CAS 38512-77-5 is the registry number for 2,3,4,5-Tetrafluoro-6-methoxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,3,4,5-tetrafluoro-6-methoxybenzoic acid (CAS 38512-77-5) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-methoxybenzoic acid. InChIKey: JUXOKWKMFYGGGI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4F4O3
Molecular weight224.11 g/mol
IUPAC name2,3,4,5-tetrafluoro-6-methoxybenzoic acid
InChIKeyJUXOKWKMFYGGGI-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C(=C1F)F)F)F)C(=O)O

Computed by PubChem (NCBI)