CAS 38512-77-5 is the registry number for 2,3,4,5-Tetrafluoro-6-methoxybenzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,4,5-tetrafluoro-6-methoxybenzoic acid (CAS 38512-77-5) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2,3,4,5-tetrafluoro-6-methoxybenzoic acid. InChIKey: JUXOKWKMFYGGGI-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2,3,4,5-tetrafluoro-6-methoxybenzoic acid |
| InChIKey | JUXOKWKMFYGGGI-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1F)F)F)F)C(=O)O |
Computed by PubChem (NCBI)