CAS 1214367-17-5 appears in our catalog under these names: 4-(Difluoromethoxy)-2,6-difluorobenzoic acid, 95%, 4-(Difluoromethoxy)-2,6-difluorobenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(difluoromethoxy)-2,6-difluorobenzoic acid (CAS 1214367-17-5) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 4-(difluoromethoxy)-2,6-difluorobenzoic acid. InChIKey: UYFODXZGBHYHBR-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 4-(difluoromethoxy)-2,6-difluorobenzoic acid |
| InChIKey | UYFODXZGBHYHBR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)C(=O)O)F)OC(F)F |
Computed by PubChem (NCBI)