Products 2379321-98-7
CAS 2379321-98-7 appears in our catalog under these names: 2-Fluoro-3-hydroxy-4-(trifluoromethyl)benzoic acid, 95%, 2-Fluoro-3-hydroxy-4-(trifluoromethyl)benzoic acid, ≥95%, ≥95%, 2-Fluoro-3-hydroxy-4-(trifluoromethyl)benzoic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2-fluoro-3-hydroxy-4-(trifluoromethyl)benzoic acid (CAS 2379321-98-7) is a chemical compound with the molecular formula C8H4F4O3 and a molecular weight of 224.11 g/mol. IUPAC name: 2-fluoro-3-hydroxy-4-(trifluoromethyl)benzoic acid. InChIKey: WIZGAUIGCJCOKR-UHFFFAOYSA-N.
| Molecular formula | C8H4F4O3 |
|---|---|
| Molecular weight | 224.11 g/mol |
| IUPAC name | 2-fluoro-3-hydroxy-4-(trifluoromethyl)benzoic acid |
| InChIKey | WIZGAUIGCJCOKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(=O)O)F)O)C(F)(F)F |
Computed by PubChem (NCBI)