cas: 900175-07-7 — see every product listed under this CAS number, including other names
2-Fluoro-4,5-dimethoxyphenylboronic acid (CAS 900175-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F627906-1G |
| cas | 900175-07-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2908.37 Pln | |
| Fluorochem | 5g | 8578.25 Pln |
| delivery time | 3-4 weeks |
|---|
(2-fluoro-4,5-dimethoxyphenyl)boronic acid (CAS 900175-07-7) is a chemical compound with the molecular formula C8H10BFO4 and a molecular weight of 199.97 g/mol. IUPAC name: (2-fluoro-4,5-dimethoxyphenyl)boronic acid. InChIKey: ZXESUNZYCLCARB-UHFFFAOYSA-N.
| Molecular formula | C8H10BFO4 |
|---|---|
| Molecular weight | 199.97 g/mol |
| IUPAC name | (2-fluoro-4,5-dimethoxyphenyl)boronic acid |
| InChIKey | ZXESUNZYCLCARB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1F)OC)OC)(O)O |
Computed by PubChem (NCBI)