cas: 603122-84-5 — see every product listed under this CAS number, including other names
2-Fluoro-4-(methoxycarbonyl)phenylboronic acid 98% (CAS 603122-84-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A268145-250mg |
| cas | 603122-84-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 225.75 Pln | |
| Ambeed | 10g | 381.50 Pln | |
| Ambeed | 25g | 670.75 Pln | |
| Ambeed | 100g | 2239.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A268145 |
(2-fluoro-4-methoxycarbonylphenyl)boronic acid (CAS 603122-84-5) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (2-fluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: BKWRLCIYMAYFPA-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (2-fluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | BKWRLCIYMAYFPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)