cas: 603122-84-5 — see every product listed under this CAS number, including other names
2-Fluoro-4-methoxycarbonylphenylboronic acid, 98% (CAS 603122-84-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 455870050 |
| cas | 603122-84-5 |
| size | 5g |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 5g | 1897.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 98% |
(2-fluoro-4-methoxycarbonylphenyl)boronic acid (CAS 603122-84-5) is a chemical compound with the molecular formula C8H8BFO4 and a molecular weight of 197.96 g/mol. IUPAC name: (2-fluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: BKWRLCIYMAYFPA-UHFFFAOYSA-N.
| Molecular formula | C8H8BFO4 |
|---|---|
| Molecular weight | 197.96 g/mol |
| IUPAC name | (2-fluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | BKWRLCIYMAYFPA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)