cas: 86256-24-8 — see every product listed under this CAS number, including other names
2-Fluoro-5-(trifluoromethoxy)benzyl bromide, 98+% (CAS 86256-24-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A781406-250mg |
| cas | 86256-24-8 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 519.19 Pln | |
| AmBeed | 5g | 5232.43 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(bromomethyl)-1-fluoro-4-(trifluoromethoxy)benzene (CAS 86256-24-8) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 2-(bromomethyl)-1-fluoro-4-(trifluoromethoxy)benzene. InChIKey: KOISGBFWQAPLFE-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 2-(bromomethyl)-1-fluoro-4-(trifluoromethoxy)benzene |
| InChIKey | KOISGBFWQAPLFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)CBr)F |
Computed by PubChem (NCBI)