Products 1092460-88-2
CAS 1092460-88-2 appears in our catalog under these names: 5-Fluoro-2-(trifluoromethoxy)benzyl bromide, 95%, 5-Fluoro-2-(trifluoromethoxy)benzyl bromide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 10g.
2-(bromomethyl)-4-fluoro-1-(trifluoromethoxy)benzene (CAS 1092460-88-2) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 2-(bromomethyl)-4-fluoro-1-(trifluoromethoxy)benzene. InChIKey: VUUGICQPCOWAIC-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 2-(bromomethyl)-4-fluoro-1-(trifluoromethoxy)benzene |
| InChIKey | VUUGICQPCOWAIC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)CBr)OC(F)(F)F |
Computed by PubChem (NCBI)