CAS 527751-45-7 is the registry number for 1-Bromo-3-(1,1,2,2-tetrafluoroethoxy)benzene, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 1g, 5g.
1-bromo-3-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 527751-45-7) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-bromo-3-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: ALQQXORYKLCHJY-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-bromo-3-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | ALQQXORYKLCHJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)OC(C(F)F)(F)F |
Computed by PubChem (NCBI)