2-Hydroxy-1-naphthoic acid, 98%+, 98%+
cas: 2283-08-1 — see every product listed under this CAS number, including other names
2-Hydroxy-1-naphthoic acid, 98%+, 98%+ (CAS 2283-08-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 250g, 500g, 1kg, 10kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114B9E-5g |
| cas | 2283-08-1 |
| size | 5g |
| availability | 10000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 362.00 Pln | |
| Chemat | 250g | 774.80 Pln | |
| Chemat | 500g | 1512.00 Pln | |
| Chemat | 1kg | 2800.40 Pln | |
| Chemat | 10kg | price on request |
properties
| purity | 98%+ |
|---|---|
| delivery time | 3 weeks |
2-hydroxynaphthalene-1-carboxylic acid (CAS 2283-08-1) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 2-hydroxynaphthalene-1-carboxylic acid. InChIKey: UPHOPMSGKZNELG-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 2-hydroxynaphthalene-1-carboxylic acid |
| InChIKey | UPHOPMSGKZNELG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
2-Hydroxy-1-naphthoic acid, 1-Naphthalenecarboxylic acid, 2-hydroxy-, 1Naphthoic acid, 2hydroxy, 1Naphthoic acid, 2hydroxy (8CI), 1-Naphthoic acid, 2-hydroxy-(8CI), 1Naphthalenecarboxylic acid, 2hydroxy, UPHOPMSGKZNELG-UHFFFAOYSA-N, 2-hydroxynaphthalene-1-carboxylic acid, Hydroxynaphthoic acid, 2-hydroxynaphthalenecarboxylic acid