cas: 39909-72-3 — see every product listed under this CAS number, including other names
2-Nitro-1,4-benzenedicarboxaldehyde, 97%, 97% (CAS 39909-72-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187K6-50mg |
| cas | 39909-72-3 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 189.20 Pln | |
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 995.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-nitroterephthalaldehyde (CAS 39909-72-3) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-nitroterephthalaldehyde. InChIKey: XKJZDFJGFMPBBG-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-nitroterephthalaldehyde |
| InChIKey | XKJZDFJGFMPBBG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C=O)[N+](=O)[O-])C=O |
Computed by PubChem (NCBI)