Products 57764-43-9
CAS 57764-43-9 is the registry number for 4-Hydroxy-1,2-benzoxazole-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-hydroxy-1,2-benzoxazole-3-carboxylic acid (CAS 57764-43-9) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 4-hydroxy-1,2-benzoxazole-3-carboxylic acid. InChIKey: ZDEFLZLIUMEXOE-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 4-hydroxy-1,2-benzoxazole-3-carboxylic acid |
| InChIKey | ZDEFLZLIUMEXOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)ON=C2C(=O)O)O |
Computed by PubChem (NCBI)