Products 1352496-53-7

CAS 1352496-53-7 is the registry number for 5-(Furan-2-yl)oxazole-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-(furan-2-yl)-1,3-oxazole-2-carboxylic acid (CAS 1352496-53-7) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 5-(furan-2-yl)-1,3-oxazole-2-carboxylic acid. InChIKey: BIVQQMFNULTWME-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO4
Molecular weight179.13 g/mol
IUPAC name5-(furan-2-yl)-1,3-oxazole-2-carboxylic acid
InChIKeyBIVQQMFNULTWME-UHFFFAOYSA-N
SMILESC1=COC(=C1)C2=CN=C(O2)C(=O)O

Computed by PubChem (NCBI)