CAS 4974-57-6 appears in our catalog under these names: 4-Nitrophenylglyoxal, 95%, 2-(4-Nitrophenyl)-2-oxoacetaldehyde, 99%, 99%, p-Nitrophenylglyoxal, 99%(LC-MS),RG. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-(4-nitrophenyl)-2-oxoacetaldehyde (CAS 4974-57-6) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-(4-nitrophenyl)-2-oxoacetaldehyde. InChIKey: ILVKBBGIGNSVDO-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-(4-nitrophenyl)-2-oxoacetaldehyde |
| InChIKey | ILVKBBGIGNSVDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)