CAS 65422-72-2 appears in our catalog under these names: 2-Oxo-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid, 95%, 2-Oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylic acid, 98%, 98%, 2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid, 98%, 2-Oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
2-oxo-3H-1,3-benzoxazole-5-carboxylic acid (CAS 65422-72-2) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-5-carboxylic acid. InChIKey: KHVGBYCMDLCIAF-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | KHVGBYCMDLCIAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=O)O2 |
Computed by PubChem (NCBI)