CAS 143659-16-9 appears in our catalog under these names: 5-(Furan-2-yl)-1,3-oxazole-4-carboxylic acid, 95%, 5-(Fur-2-yl)-1,3-oxazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 100mg, 250mg, 1g, 2,5g.
5-(furan-2-yl)-1,3-oxazole-4-carboxylic acid (CAS 143659-16-9) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 5-(furan-2-yl)-1,3-oxazole-4-carboxylic acid. InChIKey: CCXPRYRXBDOPCD-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 5-(furan-2-yl)-1,3-oxazole-4-carboxylic acid |
| InChIKey | CCXPRYRXBDOPCD-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)