CAS 42760-46-3 appears in our catalog under these names: 7-Nitrophthalide, 98%, 7-Nitro-1(3H)-isobenzofuranone, 95+%, 7–Nitro–1(3H)–isobenzofuranone. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
7-nitro-3H-2-benzofuran-1-one (CAS 42760-46-3) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 7-nitro-3H-2-benzofuran-1-one. InChIKey: BFIGXRQYMBKAIR-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 7-nitro-3H-2-benzofuran-1-one |
| InChIKey | BFIGXRQYMBKAIR-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC=C2)[N+](=O)[O-])C(=O)O1 |
Computed by PubChem (NCBI)