CAS 54903-16-1 appears in our catalog under these names: 2-Oxo-2,3-dihydro-1,3-benzoxazole-6-carboxylic acid, 95%, 2–Oxo–2,3–dihydrobenzo(d)oxazole–6–carboxylic acid, 2-Oxo-2,3-dihydro-1,3-benzoxazole-6-carboxylic acid, 2-Oxo-2,3-dihydrobenzo[d]oxazole-6-carboxylic acid 95%, 2-Oxo-2,3-dihydrobenzo[d]oxazole-6-carboxylic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 2,5g, 100mg, 10g, 25g.
2-oxo-3H-1,3-benzoxazole-6-carboxylic acid (CAS 54903-16-1) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid. InChIKey: BZRKWTCIDCRBMY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | BZRKWTCIDCRBMY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=O)N2 |
Computed by PubChem (NCBI)