CAS 134426-57-6 is the registry number for 5,6-Dihydroxy-2H-isoindole-1,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
5,6-dihydroxyisoindole-1,3-dione (CAS 134426-57-6) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 5,6-dihydroxyisoindole-1,3-dione. InChIKey: WJGNXZFELGCKHM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 5,6-dihydroxyisoindole-1,3-dione |
| InChIKey | WJGNXZFELGCKHM-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1O)O)C(=O)NC2=O |
Computed by PubChem (NCBI)