2-Oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylic acid, 98%
cas: 65422-72-2 — see every product listed under this CAS number, including other names
2-Oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylic acid, 98% (CAS 65422-72-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A780749-100mg |
| cas | 65422-72-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 464.94 Pln | |
| Ambeed | 1g | 1138.00 Pln | |
| Ambeed | 5g | 3808.00 Pln | |
| Ambeed | 25g | 13147.44 Pln | |
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 266.00 Pln | |
| Chemat | 1g | 578.00 Pln | |
| Chemat | 5g | 1701.20 Pln | |
| Chemat | 10g | 3040.40 Pln | |
| Chemat | 25g | 6126.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-oxo-3H-1,3-benzoxazole-5-carboxylic acid (CAS 65422-72-2) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-5-carboxylic acid. InChIKey: KHVGBYCMDLCIAF-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | KHVGBYCMDLCIAF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)NC(=O)O2 |
Computed by PubChem (NCBI)
Synonyms:
2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid, 2-Oxo-2,3-dihydrobenzo[d]oxazole-5-carboxylic acid, 2-Oxo-2,3-dihydro-benzooxazole-5-carboxylic acid, 2-oxo-3H-1,3-benzoxazole-5-carboxylic acid, 2-Hydroxybenzo[d]oxazole-5-carboxylic acid, 2-oxo-3-hydrobenzoxazole-5-carboxylic acid, KHVGBYCMDLCIAF-UHFFFAOYSA-N