cas: 54903-16-1 — see every product listed under this CAS number, including other names
2-Oxo-2,3-dihydrobenzo[d]oxazole-6-carboxylic acid, 98% (CAS 54903-16-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F440429-100MG |
| cas | 54903-16-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1507.82 Pln | |
| Fluorochem | 10g | 2955.23 Pln | |
| Fluorochem | 25g | 7297.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-oxo-3H-1,3-benzoxazole-6-carboxylic acid (CAS 54903-16-1) is a chemical compound with the molecular formula C8H5NO4 and a molecular weight of 179.13 g/mol. IUPAC name: 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid. InChIKey: BZRKWTCIDCRBMY-UHFFFAOYSA-N.
| Molecular formula | C8H5NO4 |
|---|---|
| Molecular weight | 179.13 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | BZRKWTCIDCRBMY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=O)N2 |
Computed by PubChem (NCBI)