2-Oxo-2h-chromene-6-carboxylic acid, 98%
cas: 7734-80-7 — see every product listed under this CAS number, including other names
2-Oxo-2h-chromene-6-carboxylic acid, 98% (CAS 7734-80-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 25g. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | QC-7984-1g |
| cas | 7734-80-7 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 731.94 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 174.80 Pln | |
| Chemat | 5g | 597.20 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 281.04 Pln | |
| BLDpharm | 5g | 780.86 Pln | |
| Fluorochem | 1g | 242.64 Pln | |
| Fluorochem | 5g | 695.61 Pln | |
| Fluorochem | 10g | 1309.97 Pln | |
| Fluorochem | 25g | 2897.96 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-oxochromene-6-carboxylic acid (CAS 7734-80-7) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 2-oxochromene-6-carboxylic acid. InChIKey: GEFDYGOYVXEKBE-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 2-oxochromene-6-carboxylic acid |
| InChIKey | GEFDYGOYVXEKBE-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1C(=O)O |
Computed by PubChem (NCBI)