CAS 1177271-53-2 is the registry number for 7-Hydroxyfuro[4,3,2-de]chromen-4(3H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
10-hydroxy-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-6-one (CAS 1177271-53-2) is a chemical compound with the molecular formula C10H6O4 and a molecular weight of 190.15 g/mol. IUPAC name: 10-hydroxy-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-6-one. InChIKey: YGLXNDOUGBEARL-UHFFFAOYSA-N.
| Molecular formula | C10H6O4 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | 10-hydroxy-2,7-dioxatricyclo[6.3.1.04,12]dodeca-1(12),3,8,10-tetraen-6-one |
| InChIKey | YGLXNDOUGBEARL-UHFFFAOYSA-N |
| SMILES | C1C2=COC3=C2C(=CC(=C3)O)OC1=O |
Computed by PubChem (NCBI)