cas: 90322-37-5 — see every product listed under this CAS number, including other names
2-Oxoindoline-4-carboxylic acid 96% (CAS 90322-37-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A210504-100mg |
| cas | 90322-37-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 353.69 Pln | |
| Ambeed | 5g | 1104.63 Pln | |
| Ambeed | 25g | 3652.25 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A210504 |
2-oxo-1,3-dihydroindole-4-carboxylic acid (CAS 90322-37-5) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: 2-oxo-1,3-dihydroindole-4-carboxylic acid. InChIKey: ALXJUSWINGKGAW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 2-oxo-1,3-dihydroindole-4-carboxylic acid |
| InChIKey | ALXJUSWINGKGAW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2NC1=O)C(=O)O |
Computed by PubChem (NCBI)