cas: 520-03-6 — see every product listed under this CAS number, including other names
2-Phenylisoindole-1,3-dione, 98% (CAS 520-03-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225209-1G |
| cas | 520-03-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 128.10 Pln | |
| Fluorochem | 5g | 237.43 Pln | |
| Fluorochem | 10g | 378.01 Pln | |
| Fluorochem | 25g | 674.78 Pln | |
| Fluorochem | 100g | 2294.00 Pln | |
| Fluorochem | 500g | 8151.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-phenylisoindole-1,3-dione (CAS 520-03-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 2-phenylisoindole-1,3-dione. InChIKey: MFUPLJQNEXUUDW-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-phenylisoindole-1,3-dione |
| InChIKey | MFUPLJQNEXUUDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)