2-Phenylisoindole-1,3-dione, 98%
cas: 520-03-6 — see every product listed under this CAS number, including other names
2-Phenylisoindole-1,3-dione, 98% (CAS 520-03-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114HVM-1g |
| cas | 520-03-6 |
| size | 1g |
| availability | 188.999g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 160.40 Pln | |
| Chemat | 10g | 246.80 Pln | |
| Chemat | 25g | 506.00 Pln | |
| Chemat | 100g | 1720.40 Pln | |
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 393.63 Pln | |
| Fluorochem | 25g | 711.23 Pln | |
| Fluorochem | 100g | 2387.72 Pln | |
| Fluorochem | 500g | 8234.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-phenylisoindole-1,3-dione (CAS 520-03-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 2-phenylisoindole-1,3-dione. InChIKey: MFUPLJQNEXUUDW-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 2-phenylisoindole-1,3-dione |
| InChIKey | MFUPLJQNEXUUDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)
Synonyms:
N-Phenylphthalimide, Phthalanil, Phthalimide, N-phenyl-, 1H-Isoindole-1,3(2H)-dione, 2-phenyl-, 2-phenylisoindole-1,3-dione, 2-Phenyl-isoindole-1,3-Dione, 2-phenylisoindoline-1,3-dione, 2-Phenyl-1H-isoindole-1,3(2H)-dione, 2-phenyl-2,3-dihydro-1H-isoindole-1,3-dione, N-Phenyl-4-nitrophthalimide