CAS 6637-45-2 appears in our catalog under these names: 1-Naphthalen-2-yl-pyrrole-2,5-dione, 1-(2-Naphthalenyl)-1h-pyrrole-2,5-dione, 95%, 1-(Naphthalen-2-yl)-1H-pyrrole-2,5-dione, 97%. Offered by: TRC, Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 100mg, 250mg, 10g.
1-naphthalen-2-ylpyrrole-2,5-dione (CAS 6637-45-2) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 1-naphthalen-2-ylpyrrole-2,5-dione. InChIKey: ISPTVBCAVIHHEF-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 1-naphthalen-2-ylpyrrole-2,5-dione |
| InChIKey | ISPTVBCAVIHHEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)N3C(=O)C=CC3=O |
Computed by PubChem (NCBI)