cas: 222180-19-0 — see every product listed under this CAS number, including other names
3'-Formyl(1,1'-biphenyl)-3-carboxylic acid, 97% (CAS 222180-19-0) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO01257CB |
| cas | 222180-19-0 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 184.80 Pln | |
| Thermo Scientific | 1g | 514.17 Pln | |
| Thermo Scientific | 5g | 1639.24 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-(3-formylphenyl)benzoic acid (CAS 222180-19-0) is a chemical compound with the molecular formula C14H10O3 and a molecular weight of 226.23 g/mol. IUPAC name: 3-(3-formylphenyl)benzoic acid. InChIKey: QOCUSJPHQSKJJR-UHFFFAOYSA-N.
| Molecular formula | C14H10O3 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | 3-(3-formylphenyl)benzoic acid |
| InChIKey | QOCUSJPHQSKJJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(=O)O)C=O |
Computed by PubChem (NCBI)