cas: 53890-77-0 — see every product listed under this CAS number, including other names
3,4-Dichloro-4'-hydroxybiphenyl, 98% (CAS 53890-77-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F400020-1G |
| cas | 53890-77-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2559.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
4-(3,4-dichlorophenyl)phenol (CAS 53890-77-0) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)phenol. InChIKey: UTTIPSVNOWSCRD-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)phenol |
| InChIKey | UTTIPSVNOWSCRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)