cas: 53890-77-0 — see every product listed under this CAS number, including other names
3′,4′-Dichloro[1,1′-biphenyl]-4-ol, 98%, 98% (CAS 53890-77-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0M6-100mg |
| cas | 53890-77-0 |
| size | 100mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 246.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-(3,4-dichlorophenyl)phenol (CAS 53890-77-0) is a chemical compound with the molecular formula C12H8Cl2O and a molecular weight of 239.09 g/mol. IUPAC name: 4-(3,4-dichlorophenyl)phenol. InChIKey: UTTIPSVNOWSCRD-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O |
|---|---|
| Molecular weight | 239.09 g/mol |
| IUPAC name | 4-(3,4-dichlorophenyl)phenol |
| InChIKey | UTTIPSVNOWSCRD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)