cas: 925910-42-5 — see every product listed under this CAS number, including other names
3,4-Difluoro-5-methoxyphenylboronic acid, 98%, 98% (CAS 925910-42-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117GMF-100mg |
| cas | 925910-42-5 |
| size | 100mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 261.20 Pln | |
| Chemat | 1g | 587.60 Pln | |
| Chemat | 5g | 1917.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3,4-difluoro-5-methoxyphenyl)boronic acid (CAS 925910-42-5) is a chemical compound with the molecular formula C7H7BF2O3 and a molecular weight of 187.94 g/mol. IUPAC name: (3,4-difluoro-5-methoxyphenyl)boronic acid. InChIKey: PKWMIAHGHFOLHX-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O3 |
|---|---|
| Molecular weight | 187.94 g/mol |
| IUPAC name | (3,4-difluoro-5-methoxyphenyl)boronic acid |
| InChIKey | PKWMIAHGHFOLHX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)F)F)OC)(O)O |
Computed by PubChem (NCBI)