cas: 851202-96-5 — see every product listed under this CAS number, including other names
3,4-Dihydro-2H-benzo[b][1,4]oxazine-7-carboxylic acid, 97%, 97% (CAS 851202-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115R0F-100mg |
| cas | 851202-96-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 482.00 Pln | |
| Chemat | 500mg | 760.40 Pln | |
| Chemat | 1g | 1101.20 Pln | |
| Chemat | 5g | 3405.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid (CAS 851202-96-5) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid. InChIKey: YCTDKGFOTACSHZ-UHFFFAOYSA-N.
| Molecular formula | C9H9NO3 |
|---|---|
| Molecular weight | 179.17 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,4-benzoxazine-7-carboxylic acid |
| InChIKey | YCTDKGFOTACSHZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(N1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)