3,5-Dibromoisonicotinic acid, 98%
cas: 13958-91-3 — see every product listed under this CAS number, including other names
3,5-Dibromoisonicotinic acid, 98% (CAS 13958-91-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236854-5G |
| cas | 13958-91-3 |
| size | 5g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 174.96 Pln | |
| Fluorochem | 10g | 289.50 Pln | |
| Fluorochem | 25g | 607.10 Pln | |
| Fluorochem | 100g | 2101.36 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3,5-dibromopyridine-4-carboxylic acid (CAS 13958-91-3) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 3,5-dibromopyridine-4-carboxylic acid. InChIKey: LRKLXFGPVUZEDK-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 3,5-dibromopyridine-4-carboxylic acid |
| InChIKey | LRKLXFGPVUZEDK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Br)C(=O)O)Br |
Computed by PubChem (NCBI)