3,6-Dibromopicolinic acid, 95%
cas: 1133116-49-0 — see every product listed under this CAS number, including other names
3,6-Dibromopicolinic acid, 95% (CAS 1133116-49-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F212746-250MG |
| cas | 1133116-49-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 466.52 Pln | |
| Fluorochem | 10g | 877.83 Pln | |
| Fluorochem | 25g | 1695.25 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3,6-dibromopyridine-2-carboxylic acid (CAS 1133116-49-0) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 3,6-dibromopyridine-2-carboxylic acid. InChIKey: YHHZRFKRFAFHRJ-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 3,6-dibromopyridine-2-carboxylic acid |
| InChIKey | YHHZRFKRFAFHRJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Br)C(=O)O)Br |
Computed by PubChem (NCBI)
Synonyms:
3,6-Dibromopicolinic acid, s10187