cas: 17965-75-2 — see every product listed under this CAS number, including other names
3,8-Dibromo-1,6-naphthyridine 97% (CAS 17965-75-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A349710-100mg |
| cas | 17965-75-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 670.75 Pln | |
| Ambeed | 250mg | 1093.50 Pln | |
| Ambeed | 1g | 2422.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A349710 |
3,8-dibromo-1,6-naphthyridine (CAS 17965-75-2) is a chemical compound with the molecular formula C8H4Br2N2 and a molecular weight of 287.94 g/mol. IUPAC name: 3,8-dibromo-1,6-naphthyridine. InChIKey: XGNQDLUHEFXGPL-UHFFFAOYSA-N.
| Molecular formula | C8H4Br2N2 |
|---|---|
| Molecular weight | 287.94 g/mol |
| IUPAC name | 3,8-dibromo-1,6-naphthyridine |
| InChIKey | XGNQDLUHEFXGPL-UHFFFAOYSA-N |
| SMILES | C1=C2C=NC=C(C2=NC=C1Br)Br |
Computed by PubChem (NCBI)