cas: 61830-40-8 — see every product listed under this CAS number, including other names
3,5–Dibromopicolinic acid (CAS 61830-40-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF32345-10g |
| cas | 61830-40-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1813.97 Pln | |
| GLPBio | 1g | 559.60 Pln | |
| GLPBio | 5g | 1130.62 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3,5-dibromopyridine-2-carboxylic acid (CAS 61830-40-8) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 3,5-dibromopyridine-2-carboxylic acid. InChIKey: BXFONYCBYSYAJE-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 3,5-dibromopyridine-2-carboxylic acid |
| InChIKey | BXFONYCBYSYAJE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)C(=O)O)Br |
Computed by PubChem (NCBI)