cas: 17137-11-0 — see every product listed under this CAS number, including other names
3-(1,3-Dioxo-1,3-dihydro-isoindol-2-yl)-propionyl chloride, 97% (CAS 17137-11-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F480874-1G |
| cas | 17137-11-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 799.74 Pln | |
| Fluorochem | 5g | 2549.12 Pln | |
| Fluorochem | 10g | 4230.82 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(1,3-dioxoisoindol-2-yl)propanoyl chloride (CAS 17137-11-0) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 3-(1,3-dioxoisoindol-2-yl)propanoyl chloride. InChIKey: ZEQHPUCQCWTFRP-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 3-(1,3-dioxoisoindol-2-yl)propanoyl chloride |
| InChIKey | ZEQHPUCQCWTFRP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC(=O)Cl |
Computed by PubChem (NCBI)