CAS 1072944-87-6 is the registry number for Methyl 4-(4-chlorophenyl)isoxazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 4-(4-chlorophenyl)-1,2-oxazole-5-carboxylate (CAS 1072944-87-6) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: methyl 4-(4-chlorophenyl)-1,2-oxazole-5-carboxylate. InChIKey: QCVYAVASMNNCGK-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | methyl 4-(4-chlorophenyl)-1,2-oxazole-5-carboxylate |
| InChIKey | QCVYAVASMNNCGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=NO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)