cas: 1049789-92-5 — see every product listed under this CAS number, including other names
3-(3-Pyridyl)aniline DiHCl, >97%, >97% (CAS 1049789-92-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114I3M-250mg |
| cas | 1049789-92-5 |
| size | 250mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 381.20 Pln | |
| Chemat | 1g | 856.40 Pln |
| purity | >97% |
|---|---|
| delivery time | 3 weeks |
3-pyridin-3-ylaniline;dihydrochloride (CAS 1049789-92-5) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 3-pyridin-3-ylaniline;dihydrochloride. InChIKey: XTQSQUBTKOMVOP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 3-pyridin-3-ylaniline;dihydrochloride |
| InChIKey | XTQSQUBTKOMVOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)