CAS 1235380-44-5 appears in our catalog under these names: 3-(Pyridin-3-yl)aniline dihydrochloride, 95%, 3-(3-Pyridyl)aniline dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g.
3-pyridin-3-ylaniline;dihydrochloride (CAS 1235380-44-5) is a chemical compound with the molecular formula C11H12Cl2N2 and a molecular weight of 243.13 g/mol. IUPAC name: 3-pyridin-3-ylaniline;dihydrochloride. InChIKey: XTQSQUBTKOMVOP-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2 |
|---|---|
| Molecular weight | 243.13 g/mol |
| IUPAC name | 3-pyridin-3-ylaniline;dihydrochloride |
| InChIKey | XTQSQUBTKOMVOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N)C2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)