cas: 1332765-59-9 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)-3-oxetanamine hydrochloride, 97% (CAS 1332765-59-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A795202-10g |
| cas | 1332765-59-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 23571.10 Pln | |
| AmBeed | 5g | 12894.70 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(4-methoxyphenyl)oxetan-3-amine;hydrochloride (CAS 1332765-59-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 3-(4-methoxyphenyl)oxetan-3-amine;hydrochloride. InChIKey: WMQAFEGROJLXAR-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)oxetan-3-amine;hydrochloride |
| InChIKey | WMQAFEGROJLXAR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(COC2)N.Cl |
Computed by PubChem (NCBI)