cas: 1332765-59-9 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)oxetan-3-amine hydrochloride, 97% (CAS 1332765-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F069621-100MG |
| cas | 1332765-59-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1070.47 Pln | |
| Fluorochem | 250mg | 1466.17 Pln | |
| Fluorochem | 1g | 4012.15 Pln | |
| Fluorochem | 500mg | 2382.51 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-methoxyphenyl)oxetan-3-amine;hydrochloride (CAS 1332765-59-9) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 3-(4-methoxyphenyl)oxetan-3-amine;hydrochloride. InChIKey: WMQAFEGROJLXAR-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)oxetan-3-amine;hydrochloride |
| InChIKey | WMQAFEGROJLXAR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2(COC2)N.Cl |
Computed by PubChem (NCBI)