cas: 465514-03-8 — see every product listed under this CAS number, including other names
3-(4-Methoxyphenyl)-5-methyl-4-isoxazolecarbonyl chloride, 97% (CAS 465514-03-8) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g, 5g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO00394CB |
| cas | 465514-03-8 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 378.25 Pln | |
| Thermo Scientific | 1g | 1033.43 Pln | |
| Thermo Scientific | 5g | 3303.93 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 97% |
3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride (CAS 465514-03-8) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride. InChIKey: FABGSPUDPOKWCR-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-5-methyl-1,2-oxazole-4-carbonyl chloride |
| InChIKey | FABGSPUDPOKWCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=C(C=C2)OC)C(=O)Cl |
Computed by PubChem (NCBI)