CAS 23464-95-1 appears in our catalog under these names: 3-[5-(4-Chlorophenyl)-1,3-oxazol-2-yl]propanoic acid, 95%, 3-(5-(4-chlorophenyl)oxazol-2-yl)propanoic acid, 95%, 3-(5-(4-Chloro-phenyl)-oxazol-2-yl)-propionic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg.
3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid (CAS 23464-95-1) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid. InChIKey: XKDNEJYXLSVRMO-UHFFFAOYSA-N.
| Molecular formula | C12H10ClNO3 |
|---|---|
| Molecular weight | 251.66 g/mol |
| IUPAC name | 3-[5-(4-chlorophenyl)-1,3-oxazol-2-yl]propanoic acid |
| InChIKey | XKDNEJYXLSVRMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(O2)CCC(=O)O)Cl |
Computed by PubChem (NCBI)