Products 1208081-71-3

CAS 1208081-71-3 is the registry number for 5-(3-Chloro-phenyl)-3-methyl-isoxazole-4-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Methyl 5-(3-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate (CAS 1208081-71-3) is a chemical compound with the molecular formula C12H10ClNO3 and a molecular weight of 251.66 g/mol. IUPAC name: methyl 5-(3-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate. InChIKey: UEJYPOXUSXCAOD-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10ClNO3
Molecular weight251.66 g/mol
IUPAC namemethyl 5-(3-chlorophenyl)-3-methyl-1,2-oxazole-4-carboxylate
InChIKeyUEJYPOXUSXCAOD-UHFFFAOYSA-N
SMILESCC1=NOC(=C1C(=O)OC)C2=CC(=CC=C2)Cl

Computed by PubChem (NCBI)