cas: 19922-07-7 — see every product listed under this CAS number, including other names
3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine, 98% (CAS 19922-07-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F771667-100MG |
| cas | 19922-07-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 500mg | 633.13 Pln | |
| Fluorochem | 1g | 789.32 Pln | |
| Fluorochem | 5g | 2970.85 Pln | |
| Fluorochem | 10g | 5886.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine (CAS 19922-07-7) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine. InChIKey: IUSHKZWNRIGLGO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | IUSHKZWNRIGLGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)N)Cl |
Computed by PubChem (NCBI)