CAS 19922-07-7 appears in our catalog under these names: 3-(4-Chlorophenyl)-1,2,4-thiadiazol-5-amine, 95%, 3-(4-Chlorophenyl)-1,2,4-thiadiazol-5-amine, 96%, 5-Amino-3-(4-chlorophenyl)-1,2,4-thiadiazole, 96% , 3-(4-Chlorophenyl)-1,2,4-thiadiazol-5-amine, 98%, 98%, 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine, 98%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 5g, 1g, 100mg, 500mg.
3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine (CAS 19922-07-7) is a chemical compound with the molecular formula C8H6ClN3S and a molecular weight of 211.67 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine. InChIKey: IUSHKZWNRIGLGO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3S |
|---|---|
| Molecular weight | 211.67 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2,4-thiadiazol-5-amine |
| InChIKey | IUSHKZWNRIGLGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NSC(=N2)N)Cl |
Computed by PubChem (NCBI)